P01303 NPY_HUMAN
Gene name: NPY
Protein name: Pro-neuropeptide Y [Cleaved into: Neuropeptide Y
List of molecules and drugs that target protein P01303
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P01303_DB00191 | DB00191 | Phentermine | inhibitor | DHHVAGZRUROJKS-UHFFFAOYSA-N | CC(C)(N)CC1=CC=CC=C1 | |
2 | P01303_DB02952 | DB02952 | 2-aminoisobutyric acid | n/a | FUOOLUPWFVMBKG-UHFFFAOYSA-N | CC(C)(N)C(O)=O | |
3 | P01303_DB03380 | DB03380 | L-tyrosinamide | n/a | PQFMNVGMJJMLAE-QMMMGPOBSA-N | [H][C@](N)(CC1=CC=C(O)C=C1)C(N)=O |