P04264 K2C1_HUMAN
Gene name: KRT1
Protein name: Keratin, type II cytoskeletal 1
List of molecules and drugs that target protein P04264
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P04264_DB01593 | DB01593 | Zinc | n/a | HCHKCACWOHOZIP-UHFFFAOYSA-N | [Zn] | |
2 | P04264_DB09130 | DB09130 | Copper | n/a | RYGMFSIKBFXOCR-UHFFFAOYSA-N | [Cu] | |
3 | P04264_DB14487 | DB14487 | Zinc acetate | n/a | DJWUNCQRNNEAKC-UHFFFAOYSA-L | [Zn++].CC([O-])=O.CC([O-])=O |