List of molecules and drugs that target protein P04439
| # | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
|---|---|---|---|---|---|---|---|
| 1 | P04439_DB02740 | DB02740 | 3-Indolebutyric Acid | n/a | JTEDVYBZBROSJT-UHFFFAOYSA-N | OC(=O)CCCC1=CNC2=C1C=CC=C2 |
List of molecules and drugs that target protein P04439
| # | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
|---|---|---|---|---|---|---|---|
| 1 | P04439_DB02740 | DB02740 | 3-Indolebutyric Acid | n/a | JTEDVYBZBROSJT-UHFFFAOYSA-N | OC(=O)CCCC1=CNC2=C1C=CC=C2 |