P07711 CATL1_HUMAN
Gene name: CTSL
Protein name: Procathepsin L
List of molecules and drugs that target protein P07711
| # | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
|---|---|---|---|---|---|---|---|
| 1 | P07711_DB03661 | DB03661 | L-cysteic acid | n/a | XVOYSCVBGLVSOL-REOHCLBHSA-N | N[C@@H](CS(O)(=O)=O)C(O)=O | |
| 2 | P07711_DB07477 | DB07477 | Felbinac | n/a | QRZAKQDHEVVFRX-UHFFFAOYSA-N | OC(=O)CC1=CC=C(C=C1)C1=CC=CC=C1 | |
| 3 | P07711_DB12010 | DB12010 | Fostamatinib | inhibitor | GKDRMWXFWHEQQT-UHFFFAOYSA-N | COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4COP(O)(O)=O)C=C3)=N2)=CC(OC)=C1OC |