P10644 KAP0_HUMAN
Gene name: PRKAR1A
Protein name: cAMP-dependent protein kinase type I-alpha regulatory subunit
List of molecules and drugs that target protein P10644
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P10644_DB01790 | DB01790 | (Rp)-cAMPS | n/a | SMPNJFHAPJOHPP-PUHOFUEYSA-N | NC1=C2N=CN([C@@H]3O[C@@H]4CO[P@](S)(=O)O[C@H]4[C@H]3O)C2=NC=N1 | |
2 | P10644_DB02315 | DB02315 | Cyclic GMP | n/a | ZOOGRGPOEVQQDX-UUOKFMHZSA-N | NC1=NC2=C(N=CN2[C@@H]2O[C@@H]3COP(O)(=O)O[C@H]3[C@H]2O)C(=O)N1 | |
3 | P10644_DB02527 | DB02527 | Cyclic adenosine monophosphate | n/a | IVOMOUWHDPKRLL-KQYNXXCUSA-N | NC1=C2N=CN([C@@H]3O[C@@H]4COP(O)(=O)O[C@H]4[C@H]3O)C2=NC=N1 |