P11142 HSP7C_HUMAN
Gene name: HSPA8
Protein name: Heat shock cognate 71 kDa protein
List of molecules and drugs that target protein P11142
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P11142_DB01254 | DB01254 | Dasatinib | n/a | ZBNZXTGUTAYRHI-UHFFFAOYSA-N | CC1=NC(NC2=NC=C(S2)C(=O)NC2=C(C)C=CC=C2Cl)=CC(=N1)N1CCN(CCO)CC1 | |
2 | P11142_DB07045 | DB07045 | (2R,3R,4S,5R)-2-[6-amino-8-[(3,4-dichlorophenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol | n/a | Kd(nM) = 3500.0 | VBJKVZXRYLCYGQ-XNIJJKJLSA-N | [H][C@]1(CO)O[C@@]([H])(N2C(NCC3=CC=C(Cl)C(Cl)=C3)=NC3=C(N)N=CN=C23)[C@]([H])(O)[C@]1([H])O |
3 | P11142_DB09130 | DB09130 | Copper | n/a | RYGMFSIKBFXOCR-UHFFFAOYSA-N | [Cu] | |
4 | P11142_DB11638 | DB11638 | Artenimol | ligand | BJDCWCLMFKKGEE-HVDUHBCDSA-N | [H][C@@]1(C)CC[C@@]2([H])[C@@]([H])(C)C([H])(O)O[C@]3([H])O[C@@]4(C)CC[C@]1([H])[C@@]23OO4 |