P19801 AOC1_HUMAN
Gene name: AOC1
Protein name: Amiloride-sensitive amine oxidase [copper-containing]
List of molecules and drugs that target protein P19801
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P19801_DB00594 | DB00594 | Amiloride | inhibitor | XSDQTOBWRPYKKA-UHFFFAOYSA-N | NC(=N)NC(=O)C1=NC(Cl)=C(N)N=C1N | |
2 | P19801_DB01373 | DB01373 | Calcium | n/a | OYPRJOBELJOOCE-UHFFFAOYSA-N | [Ca] | |
3 | P19801_DB03608 | DB03608 | Diminazene | n/a | Ki(nM) = 13.0 | XNYZHCFCZNMTFY-UHFFFAOYSA-N | NC(=N)C1=CC=C(N\N=N\C2=CC=C(C=C2)C(N)=N)C=C1 |
4 | P19801_DB05383 | DB05383 | Pimagedine | inhibitor | HAMNKKUPIHEESI-UHFFFAOYSA-N | NNC(N)=N |