P20711 DDC_HUMAN
Gene name: DDC
Protein name: Aromatic-L-amino-acid decarboxylase
List of molecules and drugs that target protein P20711
| # | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
|---|---|---|---|---|---|---|---|
| 1 | P20711_DB00114 | DB00114 | Pyridoxal phosphate | cofactor | NGVDGCNFYWLIFO-UHFFFAOYSA-N | CC1=NC=C(COP(O)(O)=O)C(C=O)=C1O | |
| 2 | P20711_DB00190 | DB00190 | Carbidopa | inhibitor | TZFNLOMSOLWIDK-JTQLQIEISA-N | C[C@@](CC1=CC(O)=C(O)C=C1)(NN)C(O)=O | |
| 3 | P20711_DB00968 | DB00968 | Methyldopa | inhibitor | CJCSPKMFHVPWAR-JTQLQIEISA-N | C[C@](N)(CC1=CC=C(O)C(O)=C1)C(O)=O | |
| 4 | P20711_DB12783 | DB12783 | Benserazide | inhibitor | BNQDCRGUHNALGH-UHFFFAOYSA-N | NC(CO)C(=O)NNCC1=C(O)C(O)=C(O)C=C1 |