P24530 EDNRB_HUMAN
Gene name: EDNRB
Protein name: Endothelin receptor type B
List of molecules and drugs that target protein P24530
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P24530_DB00559 | DB00559 | Bosentan | antagonist | Ki(nM) = 80.0 IC50(nM) = 95.0 | GJPICJJJRGTNOD-UHFFFAOYSA-N | COC1=CC=CC=C1OC1=C(NS(=O)(=O)C2=CC=C(C=C2)C(C)(C)C)N=C(N=C1OCCO)C1=NC=CC=N1 |
2 | P24530_DB06268 | DB06268 | Sitaxentan | antagonist | IC50(nM) = 9.8 | PHWXUGHIIBDVKD-UHFFFAOYSA-N | CC1=NOC(NS(=O)(=O)C2=C(SC=C2)C(=O)CC2=CC3=C(OCO3)C=C2C)=C1Cl |
3 | P24530_DB06403 | DB06403 | Ambrisentan | antagonist | OUJTZYPIHDYQMC-LJQANCHMSA-N | COC([C@H](OC1=NC(C)=CC(C)=N1)C(O)=O)(C1=CC=CC=C1)C1=CC=CC=C1 | |
4 | P24530_DB06460 | DB06460 | Enrasentan | n/a | GLCKXJLCYIJMRB-UPRLRBBYSA-N | CCCOC1=CC=C2[C@@H]([C@H]([C@@H](C2=C1)C1=CC=C(OC)C=C1OCCO)C(O)=O)C1=CC=C2OCOC2=C1 | |
5 | P24530_DB06558 | DB06558 | Tezosentan | n/a | TUYWTLTWNJOZNY-UHFFFAOYSA-N | COC1=CC=CC=C1OC1=C(NS(=O)(=O)C2=NC=C(C=C2)C(C)C)N=C(N=C1OCCO)C1=CC(=NC=C1)C1=NNN=N1 | |
6 | P24530_DB08932 | DB08932 | Macitentan | antagonist | IC50(nM) = 391.0 | JGCMEBMXRHSZKX-UHFFFAOYSA-N | CCCNS(=O)(=O)NC1=C(C(OCCOC2=NC=C(Br)C=N2)=NC=N1)C1=CC=C(Br)C=C1 |