P29317 EPHA2_HUMAN
Gene name: EPHA2
Protein name: Ephrin type-A receptor 2
List of molecules and drugs that target protein P29317
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P29317_DB01254 | DB01254 | Dasatinib | antagonist | IC50(nM) = 0.8 Kd(nM) = 0.85 | ZBNZXTGUTAYRHI-UHFFFAOYSA-N | CC1=NC(NC2=NC=C(S2)C(=O)NC2=C(C)C=CC=C2Cl)=CC(=N1)N1CCN(CCO)CC1 |
2 | P29317_DB04395 | DB04395 | Phosphoaminophosphonic Acid-Adenylate Ester | n/a | PVKSNHVPLWYQGJ-FCIPNVEPSA-N | NC1=NC=NC2=C1N=CN2[C@@H]1O[C@@H](CO[P@](O)(=O)O[P@@](O)(=O)NP(O)(O)=O)[C@H](O)[C@H]1O | |
3 | P29317_DB08896 | DB08896 | Regorafenib | inhibitor | Kd(nM) = 869.0 | FNHKPVJBJVTLMP-UHFFFAOYSA-N | CNC(=O)C1=CC(OC2=CC(F)=C(NC(=O)NC3=CC=C(Cl)C(=C3)C(F)(F)F)C=C2)=CC=N1 |
4 | P29317_DB12010 | DB12010 | Fostamatinib | inhibitor | GKDRMWXFWHEQQT-UHFFFAOYSA-N | COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4COP(O)(O)=O)C=C3)=N2)=CC(OC)=C1OC |