P29323 EPHB2_HUMAN
Gene name: EPHB2
Protein name: Ephrin type-B receptor 2
List of molecules and drugs that target protein P29323
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P29323_DB04395 | DB04395 | Phosphoaminophosphonic Acid-Adenylate Ester | n/a | PVKSNHVPLWYQGJ-FCIPNVEPSA-N | NC1=NC=NC2=C1N=CN2[C@@H]1O[C@@H](CO[P@](O)(=O)O[P@@](O)(=O)NP(O)(O)=O)[C@H](O)[C@H]1O | |
2 | P29323_DB12010 | DB12010 | Fostamatinib | inhibitor | GKDRMWXFWHEQQT-UHFFFAOYSA-N | COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4COP(O)(O)=O)C=C3)=N2)=CC(OC)=C1OC | |
3 | P29323_DB12843 | DB12843 | Oleandrin | activator | JLPDBLFIVFSOCC-XYXFTTADSA-N | CO[C@H]1C[C@H](O[C@H]2CC[C@@]3(C)[C@H](CC[C@@H]4[C@@H]3CC[C@]3(C)[C@H]([C@H](C[C@]43O)OC(C)=O)C3=CC(=O)OC3)C2)O[C@@H](C)[C@@H]1O |