P30531 SC6A1_HUMAN
Gene name: SLC6A1
Protein name: Sodium- and chloride-dependent GABA transporter 1
List of molecules and drugs that target protein P30531
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P30531_DB00906 | DB00906 | Tiagabine | inhibitor | Ki(nM) = 16.98 IC50(nM) = 49.0 Kd(nM) = 41.0 | PBJUNZJWGZTSKL-MRXNPFEDSA-N | CC1=C(SC=C1)C(=CCCN1CCC[C@H](C1)C(O)=O)C1=C(C)C=CS1 |
2 | P30531_DB08848 | DB08848 | Guvacine | inhibitor | IC50(nM) = 14000.0 | QTDZOWFRBNTPQR-UHFFFAOYSA-N | OC(=O)C1=CCCNC1 |