P30825 SL7A1_HUMAN
Gene name: SLC7A1
Protein name: High affinity cationic amino acid transporter 1
List of molecules and drugs that target protein P30825
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P30825_DB00123 | DB00123 | Lysine | n/a | KDXKERNSBIXSRK-YFKPBYRVSA-N | NCCCC[C@H](N)C(O)=O | |
2 | P30825_DB00125 | DB00125 | Arginine | n/a | ODKSFYDXXFIFQN-BYPYZUCNSA-N | N[C@@H](CCCNC(N)=N)C(O)=O | |
3 | P30825_DB00129 | DB00129 | Ornithine | n/a | AHLPHDHHMVZTML-BYPYZUCNSA-N | NCCC[C@H](N)C(O)=O |