P43405 KSYK_HUMAN
Gene name: SYK
Protein name: Tyrosine-protein kinase SYK
List of molecules and drugs that target protein P43405
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P43405_DB02010 | DB02010 | Staurosporine | n/a | HKSZLNNOFSGOKW-FYTWVXJKSA-N | [H][C@]1(C[C@@]2([H])O[C@](C)(N3C4=CC=CC=C4C4=C5CNC(=O)C5=C5C6=CC=CC=C6N2C5=C34)[C@]1([H])OC)NC | |
2 | P43405_DB06834 | DB06834 | N-(2-hydroxy-1,1-dimethylethyl)-1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-2-yl)-1H-indole-5-carboxamide | n/a | IC50(nM) = 570.0 | XZRYCTLOGNCQDG-UHFFFAOYSA-N | CN1C=C(C2=CC3=CC=CN=C3N2)C2=CC(=CC=C12)C(=O)NC(C)(C)CO |
3 | P43405_DB07159 | DB07159 | Tamatinib | inhibitor | Ki(nM) = 30.0 IC50(nM) = 5.5 Kd(nM) = 19.0 EC50(nM) = 10.0 | NHHQJBCNYHBUSI-UHFFFAOYSA-N | COC1=CC(NC2=NC=C(F)C(NC3=CC=C4OC(C)(C)C(=O)NC4=N3)=N2)=CC(OC)=C1OC |
4 | P43405_DB07194 | DB07194 | 2-{2-[(3,5-dimethylphenyl)amino]pyrimidin-4-yl}-N-[(1S)-2-hydroxy-1-methylethyl]-4-methyl-1,3-thiazole-5-carboxamide | n/a | Ki(nM) = 9.0 IC50(nM) = 6.0 | PEGXADGTBNRSGV-ZDUSSCGKSA-N | [H][C@](C)(CO)NC(=O)C1=C(C)N=C(S1)C1=NC(NC2=CC(C)=CC(C)=C2)=NC=C1 |
5 | P43405_DB08361 | DB08361 | 2-{[(1R,2S)-2-aminocyclohexyl]amino}-4-[(3-methylphenyl)amino]pyrimidine-5-carboxamide | n/a | IC50(nM) = 4.0 EC50(nM) = 2500.0 | NZNTWOVDIXCHHS-LSDHHAIUSA-N | [H][C@]1(N)CCCC[C@@]1([H])NC1=NC(NC2=CC=CC(C)=C2)=C(C=N1)C(N)=O |
6 | P43405_DB08846 | DB08846 | Ellagic acid | inhibitor | AFSDNFLWKVMVRB-UHFFFAOYSA-N | OC1=C(O)C2=C3C(=C1)C(=O)OC1=C3C(=CC(O)=C1O)C(=O)O2 | |
7 | P43405_DB12010 | DB12010 | Fostamatinib | inhibitor | GKDRMWXFWHEQQT-UHFFFAOYSA-N | COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4COP(O)(O)=O)C=C3)=N2)=CC(OC)=C1OC | |
8 | P43405_DB12121 | DB12121 | Entospletinib | inhibitor | XSMSNFMDVXXHGJ-UHFFFAOYSA-N | C1CN(CCO1)C1=CC=C(NC2=NC(=CN3C=CN=C23)C2=CC3=C(C=NN3)C=C2)C=C1 |