P47870 GBRB2_HUMAN
Gene name: GABRB2
Protein name: Gamma-aminobutyric acid receptor subunit beta-2
List of molecules and drugs that target protein P47870
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P47870_DB00395 | DB00395 | Carisoprodol | modulator | OFZCIYFFPZCNJE-UHFFFAOYSA-N | CCCC(C)(COC(N)=O)COC(=O)NC(C)C | |
2 | P47870_DB00818 | DB00818 | Propofol | potentiator | OLBCVFGFOZPWHH-UHFFFAOYSA-N | CC(C)C1=CC=CC(C(C)C)=C1O | |
3 | P47870_DB00898 | DB00898 | Ethanol | n/a | LFQSCWFLJHTTHZ-UHFFFAOYSA-N | CCO | |
4 | P47870_DB01567 | DB01567 | Fludiazepam | potentiator | ROYOYTLGDLIGBX-UHFFFAOYSA-N | CN1C2=C(C=C(Cl)C=C2)C(=NCC1=O)C1=CC=CC=C1F | |
5 | P47870_DB06716 | DB06716 | Fospropofol | potentiator | QVNNONOFASOXQV-UHFFFAOYSA-N | CC(C)C1=CC=CC(C(C)C)=C1OCOP(O)(O)=O |