P48048 KCNJ1_HUMAN
Gene name: KCNJ1
Protein name: ATP-sensitive inward rectifier potassium channel 1
List of molecules and drugs that target protein P48048
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P48048_DB00217 | DB00217 | Bethanidine | inhibitor | NIVZHWNOUVJHKV-UHFFFAOYSA-N | CN\C(NCC1=CC=CC=C1)=N/C | |
2 | P48048_DB00222 | DB00222 | Glimepiride | inhibitor | WIGIZIANZCJQQY-RUCARUNLSA-N | CCC1=C(C)CN(C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)NC(=O)N[C@H]2CC[C@H](C)CC2)C1=O | |
3 | P48048_DB00350 | DB00350 | Minoxidil | inducer | ZFMITUMMTDLWHR-UHFFFAOYSA-N | NC1=CC(=NC(N)=[N+]1[O-])N1CCCCC1 | |
4 | P48048_DB00414 | DB00414 | Acetohexamide | inhibitor | VGZSUPCWNCWDAN-UHFFFAOYSA-N | CC(=O)C1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCC1 | |
5 | P48048_DB01124 | DB01124 | Tolbutamide | inhibitor | JLRGJRBPOGGCBT-UHFFFAOYSA-N | CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 | |
6 | P48048_DB01382 | DB01382 | Glymidine | other/unknown | QFWPJPIVLCBXFJ-UHFFFAOYSA-N | COCCOC1=CN=C(NS(=O)(=O)C2=CC=CC=C2)N=C1 | |
7 | P48048_DB08838 | DB08838 | Agmatine | antagonist | QYPPJABKJHAVHS-UHFFFAOYSA-N | NCCCCNC(N)=N |