P48169 GBRA4_HUMAN
Gene name: GABRA4
Protein name: Gamma-aminobutyric acid receptor subunit alpha-4
List of molecules and drugs that target protein P48169
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P48169_DB00241 | DB00241 | Butalbital | potentiator | UZVHFVZFNXBMQJ-UHFFFAOYSA-N | CC(C)CC1(CC=C)C(=O)NC(=O)NC1=O | |
2 | P48169_DB00306 | DB00306 | Talbutal | potentiator | BJVVMKUXKQHWJK-UHFFFAOYSA-N | CCC(C)C1(CC=C)C(=O)NC(=O)NC1=O | |
3 | P48169_DB00312 | DB00312 | Pentobarbital | potentiator | WEXRUCMBJFQVBZ-UHFFFAOYSA-N | CCCC(C)C1(CC)C(=O)NC(=O)NC1=O | |
4 | P48169_DB00371 | DB00371 | Meprobamate | agonist | NPPQSCRMBWNHMW-UHFFFAOYSA-N | CCCC(C)(COC(N)=O)COC(N)=O | |
5 | P48169_DB00418 | DB00418 | Secobarbital | potentiator | KQPKPCNLIDLUMF-UHFFFAOYSA-N | CCCC(C)C1(CC=C)C(=O)NC(=O)NC1=O | |
6 | P48169_DB00463 | DB00463 | Metharbital | potentiator | FWJKNZONDWOGMI-UHFFFAOYSA-N | CCC1(CC)C(=O)NC(=O)N(C)C1=O | |
7 | P48169_DB00599 | DB00599 | Thiopental | potentiator | IUJDSEJGGMCXSG-UHFFFAOYSA-N | CCCC(C)C1(CC)C(=O)NC(=S)NC1=O | |
8 | P48169_DB00794 | DB00794 | Primidone | potentiator | DQMZLTXERSFNPB-UHFFFAOYSA-N | CCC1(C(=O)NCNC1=O)C1=CC=CC=C1 | |
9 | P48169_DB00849 | DB00849 | Methylphenobarbital | potentiator | ALARQZQTBTVLJV-UHFFFAOYSA-N | CCC1(C(=O)NC(=O)N(C)C1=O)C1=CC=CC=C1 | |
10 | P48169_DB00898 | DB00898 | Ethanol | n/a | LFQSCWFLJHTTHZ-UHFFFAOYSA-N | CCO | |
11 | P48169_DB01351 | DB01351 | Amobarbital | potentiator | VIROVYVQCGLCII-UHFFFAOYSA-N | CCC1(CCC(C)C)C(=O)NC(=O)NC1=O | |
12 | P48169_DB01352 | DB01352 | Aprobarbital | potentiator | UORJNBVJVRLXMQ-UHFFFAOYSA-N | CC(C)C1(CC=C)C(=O)NC(=O)NC1=O | |
13 | P48169_DB01353 | DB01353 | Butobarbital | potentiator | STDBAQMTJLUMFW-UHFFFAOYSA-N | CCCCC1(CC)C(=O)NC(=O)NC1=O | |
14 | P48169_DB01354 | DB01354 | Heptabarbital | potentiator | PAZQYDJGLKSCSI-UHFFFAOYSA-N | CCC1(C(=O)NC(=O)NC1=O)C1=CCCCCC1 | |
15 | P48169_DB01355 | DB01355 | Hexobarbital | potentiator | UYXAWHWODHRRMR-UHFFFAOYSA-N | CN1C(=O)NC(=O)C(C)(C1=O)C1=CCCCC1 | |
16 | P48169_DB01483 | DB01483 | Barbital | potentiator | FTOAOBMCPZCFFF-UHFFFAOYSA-N | CCC1(CC)C(=O)NC(=O)NC1=O | |
17 | P48169_DB01496 | DB01496 | Dihydro-2-thioxo-5-((5-(2-(trifluoromethyl)phenyl)-2-furanyl)methyl)-4,6(1H,5H)-pyrimidinedione | potentiator | DNZPLHRZXUJATK-UHFFFAOYSA-N | FC(F)(F)C1=CC=CC=C1C1=CC=C(CC2C(=O)NC(=S)NC2=O)O1 |