P61769 B2MG_HUMAN
Gene name: B2M
Protein name: Beta-2-microglobulin [Cleaved into: Beta-2-microglobulin form pI 5.3]
List of molecules and drugs that target protein P61769
| # | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
|---|---|---|---|---|---|---|---|
| 1 | P61769_DB02740 | DB02740 | 3-Indolebutyric Acid | n/a | JTEDVYBZBROSJT-UHFFFAOYSA-N | OC(=O)CCCC1=CNC2=C1C=CC=C2 | |
| 2 | P61769_DB04464 | DB04464 | N-Formylmethionine | n/a | PYUSHNKNPOHWEZ-YFKPBYRVSA-N | [H]C(=O)N[C@@H](CCSC)C(O)=O | |
| 3 | P61769_DB09130 | DB09130 | Copper | n/a | RYGMFSIKBFXOCR-UHFFFAOYSA-N | [Cu] |