Q09428 ABCC8_HUMAN
Gene name: ABCC8
Protein name: ATP-binding cassette sub-family C member 8
List of molecules and drugs that target protein Q09428
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | Q09428_DB00171 | DB00171 | ATP | n/a | ZKHQWZAMYRWXGA-KQYNXXCUSA-N | NC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O | |
2 | Q09428_DB00222 | DB00222 | Glimepiride | inducer | WIGIZIANZCJQQY-RUCARUNLSA-N | CCC1=C(C)CN(C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)NC(=O)N[C@H]2CC[C@H](C)CC2)C1=O | |
3 | Q09428_DB00672 | DB00672 | Chlorpropamide | inhibitor | RKWGIWYCVPQPMF-UHFFFAOYSA-N | CCCNC(=O)NS(=O)(=O)C1=CC=C(Cl)C=C1 | |
4 | Q09428_DB00731 | DB00731 | Nateglinide | inhibitor | OELFLUMRDSZNSF-BRWVUGGUSA-N | CC(C)[C@H]1CC[C@@H](CC1)C(=O)N[C@H](CC1=CC=CC=C1)C(O)=O | |
5 | Q09428_DB00912 | DB00912 | Repaglinide | inhibitor | IC50(nM) = 106.0 Kd(nM) = 50.0 | FAEKWTJYAYMJKF-QHCPKHFHSA-N | CCOC1=C(C=CC(CC(=O)N[C@@H](CC(C)C)C2=CC=CC=C2N2CCCCC2)=C1)C(O)=O |
6 | Q09428_DB01067 | DB01067 | Glipizide | inhibitor | ZJJXGWJIGJFDTL-UHFFFAOYSA-N | CC1=NC=C(N=C1)C(=O)NCCC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCC1 | |
7 | Q09428_DB01120 | DB01120 | Gliclazide | binder | BOVGTQGAOIONJV-BETUJISGSA-N | [H][C@@]12CCC[C@]1([H])CN(C2)NC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 | |
8 | Q09428_DB01124 | DB01124 | Tolbutamide | inhibitor | JLRGJRBPOGGCBT-UHFFFAOYSA-N | CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 | |
9 | Q09428_DB01251 | DB01251 | Gliquidone | inhibitor | LLJFMFZYVVLQKT-UHFFFAOYSA-N | COC1=CC2=C(C=C1)C(C)(C)C(=O)N(CCC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCC1)C2=O | |
10 | Q09428_DB01252 | DB01252 | Mitiglinide | inhibitor | WPGGHFDDFPHPOB-BBWFWOEESA-N | [H][C@@](CC(=O)N1C[C@@]2([H])CCCC[C@@]2([H])C1)(CC1=CC=CC=C1)C(O)=O | |
11 | Q09428_DB01382 | DB01382 | Glymidine | inducer | QFWPJPIVLCBXFJ-UHFFFAOYSA-N | COCCOC1=CN=C(NS(=O)(=O)C2=CC=CC=C2)N=C1 |