Q13126 MTAP_HUMAN
Gene name: MTAP
Protein name: S-methyl-5'-thioadenosine phosphorylase
List of molecules and drugs that target protein Q13126
| # | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
|---|---|---|---|---|---|---|---|
| 1 | Q13126_DB00173 | DB00173 | Adenine | n/a | GFFGJBXGBJISGV-UHFFFAOYSA-N | NC1=C2NC=NC2=NC=N1 | |
| 2 | Q13126_DB02158 | DB02158 | (2S,3S,4R,5S)-2-(4-Amino-4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidin-7-yl)-5-[(methylsulfanyl)methyl]-3,4-pyrrolidinediol | n/a | YLCQGEBEQIBOOJ-BOFBLULFSA-N | CSC[C@H]1N[C@H]([C@H](O)[C@@H]1O)C1=CNC2=C1N=CNC2N | |
| 3 | Q13126_DB02281 | DB02281 | Formycin | n/a | KBHMEHLJSZMEMI-KSYZLYKTSA-N | [H][C@]1(CO)O[C@@]([H])(C2=C3N=CN=C(N)C3=NN2)[C@]([H])(O)[C@]1([H])O | |
| 4 | Q13126_DB02282 | DB02282 | 5'-S-methyl-5'-thioadenosine | n/a | WUUGFSXJNOTRMR-IOSLPCCCSA-N | CSC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=NC2=C1N=CN=C2N | |
| 5 | Q13126_DB02933 | DB02933 | 5'-Deoxy-5'-(Methylthio)-Tubercidin | n/a | WBPLMFVTQMIPLW-MFYTUXHUSA-N | [H][C@]1(CSC)O[C@@]([H])(N2C=CC3=C(N)N=CN=C23)[C@]([H])(O)[C@]1([H])O |