Q13370 PDE3B_HUMAN
Gene name: PDE3B
Protein name: cGMP-inhibited 3',5'-cyclic phosphodiesterase B
List of molecules and drugs that target protein Q13370
| # | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
|---|---|---|---|---|---|---|---|
| 1 | Q13370_DB01427 | DB01427 | Amrinone | inhibitor | RNLQIBCLLYYYFJ-UHFFFAOYSA-N | NC1=CC(=CNC1=O)C1=CC=NC=C1 | |
| 2 | Q13370_DB01640 | DB01640 | 6-(4-{[2-(3-iodobenzyl)-3-oxocyclohex-1-en-1-yl]amino}phenyl)-5-methyl-4,5-dihydropyridazin-3(2H)-one | n/a | QNURTFDBHAQRSI-OAHLLOKOSA-N | C[C@@H]1CC(=O)NN=C1C1=CC=C(NC2=C(CC3=CC(I)=CC=C3)C(=O)CCC2)C=C1 | |
| 3 | Q13370_DB01970 | DB01970 | Hg9a-9, Nonanoyl-N-Hydroxyethylglucamide | n/a | REPLXGVUTGZQCG-WTTBNOFXSA-N | [H][C@](O)(CO)[C@]([H])(O)[C@]([H])(O)[C@]([H])(O)CN(CCO)C(=O)CCCCCCCC | |
| 4 | Q13370_DB07954 | DB07954 | 3-isobutyl-1-methyl-7H-xanthine | n/a | IC50(nM) = 242.0 | APIXJSLKIYYUKG-UHFFFAOYSA-N | CC(C)CN1C2=C(N=CN2)C(=O)N(C)C1=O |