Q13946 PDE7A_HUMAN
Gene name: PDE7A
Protein name: High affinity cAMP-specific 3',5'-cyclic phosphodiesterase 7A
List of molecules and drugs that target protein Q13946
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | Q13946_DB07954 | DB07954 | 3-isobutyl-1-methyl-7H-xanthine | n/a | Ki(nM) = 4000.0 IC50(nM) = 85600.0 | APIXJSLKIYYUKG-UHFFFAOYSA-N | CC(C)CN1C2=C(N=CN2)C(=O)N(C)C1=O |
2 | Q13946_DB08602 | DB08602 | 3-(2,6-difluorophenyl)-2-(methylthio)quinazolin-4(3H)-one | n/a | BFNBJSXMXXQLAW-UHFFFAOYSA-N | CSC1=NC2=CC=CC=C2C(=O)N1C1=C(F)C=CC=C1F |