Q14432 PDE3A_HUMAN
Gene name: PDE3A
Protein name: cGMP-inhibited 3',5'-cyclic phosphodiesterase A
List of molecules and drugs that target protein Q14432
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | Q14432_DB00235 | DB00235 | Milrinone | inhibitor | Ki(nM) = 150.0 IC50(nM) = 210.0 | PZRHRDRVRGEVNW-UHFFFAOYSA-N | CC1=C(C=C(C#N)C(=O)N1)C1=CC=NC=C1 |
2 | Q14432_DB00261 | DB00261 | Anagrelide | inhibitor | IC50(nM) = 50.0 | OTBXOEAOVRKTNQ-UHFFFAOYSA-N | ClC1=CC=C2N=C3NC(=O)CN3CC2=C1Cl |
3 | Q14432_DB00277 | DB00277 | Theophylline | inhibitor | IC50(nM) = 360000.0 | ZFXYFBGIUFBOJW-UHFFFAOYSA-N | CN1C2=C(NC=N2)C(=O)N(C)C1=O |
4 | Q14432_DB00922 | DB00922 | Levosimendan | inhibitor | WHXMKTBCFHIYNQ-SECBINFHSA-N | C[C@@H]1CC(=O)NN=C1C1=CC=C(NN=C(C#N)C#N)C=C1 | |
5 | Q14432_DB01166 | DB01166 | Cilostazol | inhibitor | RRGUKTPIGVIEKM-UHFFFAOYSA-N | O=C1CCC2=C(N1)C=CC(OCCCCC1=NN=NN1C1CCCCC1)=C2 | |
6 | Q14432_DB01223 | DB01223 | Aminophylline | inhibitor | FQPFAHBPWDRTLU-UHFFFAOYSA-N | NCCN.CN1C2=C(NC=N2)C(=O)N(C)C1=O.CN1C2=C(NC=N2)C(=O)N(C)C1=O | |
7 | Q14432_DB01303 | DB01303 | Oxtriphylline | inhibitor | RLANKEDHRWMNRO-UHFFFAOYSA-M | C[N+](C)(C)CCO.CN1C2=C([N-]C=N2)C(=O)N(C)C1=O | |
8 | Q14432_DB01427 | DB01427 | Amrinone | inhibitor | IC50(nM) = 16000.0 | RNLQIBCLLYYYFJ-UHFFFAOYSA-N | NC1=CC(=CNC1=O)C1=CC=NC=C1 |
9 | Q14432_DB04880 | DB04880 | Enoximone | inhibitor | IC50(nM) = 3800.0 | ZJKNESGOIKRXQY-UHFFFAOYSA-N | CSC1=CC=C(C=C1)C(=O)C1=C(C)NC(=O)N1 |
10 | Q14432_DB05266 | DB05266 | Ibudilast | inhibitor | IC50(nM) = 299000.0 | ZJVFLBOZORBYFE-UHFFFAOYSA-N | CC(C)C(=O)C1=C2C=CC=CN2N=C1C(C)C |
11 | Q14432_DB08811 | DB08811 | Tofisopam | inhibitor | RUJBDQSFYCKFAA-UHFFFAOYSA-N | CCC1C2=CC(OC)=C(OC)C=C2C(=NN=C1C)C1=CC(OC)=C(OC)C=C1 |