Q15303 ERBB4_HUMAN
Gene name: ERBB4
Protein name: Receptor tyrosine-protein kinase erbB-4
List of molecules and drugs that target protein Q15303
| # | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
|---|---|---|---|---|---|---|---|
| 1 | Q15303_DB08916 | DB08916 | Afatinib | inhibitor | IC50(nM) = 1.0 Kd(nM) = 6.3 | ULXXDDBFHOBEHA-CWDCEQMOSA-N | CN(C)C\C=C\C(=O)NC1=C(O[C@H]2CCOC2)C=C2N=CN=C(NC3=CC(Cl)=C(F)C=C3)C2=C1 |
| 2 | Q15303_DB12010 | DB12010 | Fostamatinib | inhibitor | GKDRMWXFWHEQQT-UHFFFAOYSA-N | COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4COP(O)(O)=O)C=C3)=N2)=CC(OC)=C1OC | |
| 3 | Q15303_DB12267 | DB12267 | Brigatinib | inhibitor | AILRADAXUVEEIR-UHFFFAOYSA-N | COC1=CC(=CC=C1NC1=NC=C(Cl)C(NC2=CC=CC=C2P(C)(C)=O)=N1)N1CCC(CC1)N1CCN(C)CC1 | |
| 4 | Q15303_DB15035 | DB15035 | Zanubrutinib | inhibitor | RNOAOAWBMHREKO-QFIPXVFZSA-N | NC(=O)C1=C2NCC[C@@H](C3CCN(CC3)C(=O)C=C)N2N=C1C1=CC=C(OC2=CC=CC=C2)C=C1 |