Q8WY07 CTR3_HUMAN
Gene name: SLC7A3
Protein name: Cationic amino acid transporter 3
List of molecules and drugs that target protein Q8WY07
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | Q8WY07_DB00123 | DB00123 | Lysine | n/a | KDXKERNSBIXSRK-YFKPBYRVSA-N | NCCCC[C@H](N)C(O)=O | |
2 | Q8WY07_DB00125 | DB00125 | Arginine | n/a | ODKSFYDXXFIFQN-BYPYZUCNSA-N | N[C@@H](CCCNC(N)=N)C(O)=O | |
3 | Q8WY07_DB13146 | DB13146 | Fluciclovine (18F) | binder | NTEDWGYJNHZKQW-DGMDOPGDSA-N | N[C@]1(C[C@H]([18F])C1)C(O)=O |