Q92696 PGTA_HUMAN
Gene name: RABGGTA
Protein name: Geranylgeranyl transferase type-2 subunit alpha
List of molecules and drugs that target protein Q92696
| # | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
|---|---|---|---|---|---|---|---|
| 1 | Q92696_DB04464 | DB04464 | N-Formylmethionine | n/a | PYUSHNKNPOHWEZ-YFKPBYRVSA-N | [H]C(=O)N[C@@H](CCSC)C(O)=O | |
| 2 | Q92696_DB07780 | DB07780 | Farnesyl diphosphate | n/a | VWFJDQUYCIWHTN-YFVJMOTDSA-N | CC(C)=CCC\C(C)=C\CC\C(C)=C\COP(O)(=O)OP(O)(O)=O | |
| 3 | Q92696_DB07841 | DB07841 | Geranylgeranyl diphosphate | n/a | OINNEUNVOZHBOX-UHFFFAOYSA-N | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(O)(=O)OP(O)(O)=O |