Q93088 BHMT1_HUMAN
Gene name: BHMT
Protein name: Betaine--homocysteine S-methyltransferase 1
List of molecules and drugs that target protein Q93088
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | Q93088_DB00134 | DB00134 | Methionine | product of | FFEARJCKVFRZRR-BYPYZUCNSA-N | CSCC[C@H](N)C(O)=O | |
2 | Q93088_DB02337 | DB02337 | S-(D-Carboxybutyl)-L-Homocysteine | n/a | BMONDXDFXRPNKQ-ZETCQYMHSA-N | N[C@@H](CCSCCCCC(O)=O)C(O)=O | |
3 | Q93088_DB06756 | DB06756 | Betaine | substrate | KWIUHFFTVRNATP-UHFFFAOYSA-N | C[N+](C)(C)CC([O-])=O |