Q96QT4 TRPM7_HUMAN
Gene name: TRPM7
Protein name: Transient receptor potential cation channel subfamily M member 7
List of molecules and drugs that target protein Q96QT4
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | Q96QT4_DB00179 | DB00179 | Masoprocol | inhibitor | HCZKYJDFEPMADG-TXEJJXNPSA-N | C[C@@H](CC1=CC(O)=C(O)C=C1)[C@H](C)CC1=CC(O)=C(O)C=C1 | |
2 | Q96QT4_DB04395 | DB04395 | Phosphoaminophosphonic Acid-Adenylate Ester | n/a | PVKSNHVPLWYQGJ-FCIPNVEPSA-N | NC1=NC=NC2=C1N=CN2[C@@H]1O[C@@H](CO[P@](O)(=O)O[P@@](O)(=O)NP(O)(O)=O)[C@H](O)[C@H]1O | |
3 | Q96QT4_DB04447 | DB04447 | 1,4-Dithiothreitol | n/a | VHJLVAABSRFDPM-IMJSIDKUSA-N | O[C@@H](CS)[C@@H](O)CS |