Q96SW2 CRBN_HUMAN
Gene name: CRBN
Protein name: Protein cereblon
List of molecules and drugs that target protein Q96SW2
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | Q96SW2_DB00480 | DB00480 | Lenalidomide | inhibitor | Ki(nM) = 1490.0 IC50(nM) = 2000.0 | GOTYRUGSSMKFNF-UHFFFAOYSA-N | NC1=CC=CC2=C1CN(C1CCC(=O)NC1=O)C2=O |
2 | Q96SW2_DB01041 | DB01041 | Thalidomide | inhibitor | Ki(nM) = 8510.0 IC50(nM) = 22900.0 | UEJJHQNACJXSKW-UHFFFAOYSA-N | O=C1N(C2CCC(=O)NC2=O)C(=O)C2=CC=CC=C12 |
3 | Q96SW2_DB08910 | DB08910 | Pomalidomide | inhibitor | Ki(nM) = 10000.0 IC50(nM) = 2000.0 Kd(nM) = 5100.0 | UVSMNLNDYGZFPF-UHFFFAOYSA-N | NC1=CC=CC2=C1C(=O)N(C1CCC(=O)NC1=O)C2=O |