Q9BYV1 AGT2_HUMAN
Gene name: AGXT2
Protein name: Alanine--glyoxylate aminotransferase 2, mitochondrial
List of molecules and drugs that target protein Q9BYV1
| # | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
|---|---|---|---|---|---|---|---|
| 1 | Q9BYV1_DB00114 | DB00114 | Pyridoxal phosphate | cofactor | NGVDGCNFYWLIFO-UHFFFAOYSA-N | CC1=NC=C(COP(O)(O)=O)C(C=O)=C1O | |
| 2 | Q9BYV1_DB00119 | DB00119 | Pyruvic acid | n/a | LCTONWCANYUPML-UHFFFAOYSA-N | CC(=O)C(O)=O | |
| 3 | Q9BYV1_DB00145 | DB00145 | Glycine | product of | DHMQDGOQFOQNFH-UHFFFAOYSA-N | NCC(O)=O | |
| 4 | Q9BYV1_DB00160 | DB00160 | Alanine | n/a | QNAYBMKLOCPYGJ-REOHCLBHSA-N | C[C@H](N)C(O)=O |