Q9H244 P2Y12_HUMAN
Gene name: P2RY12
Protein name: P2Y purinoceptor 12
List of molecules and drugs that target protein Q9H244
| # | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
|---|---|---|---|---|---|---|---|
| 1 | Q9H244_DB00208 | DB00208 | Ticlopidine | antagonist | PHWBOXQYWZNQIN-UHFFFAOYSA-N | ClC1=CC=CC=C1CN1CCC2=C(C1)C=CS2 | |
| 2 | Q9H244_DB00374 | DB00374 | Treprostinil | agonist | PAJMKGZZBBTTOY-ZFORQUDYSA-N | [H][C@]12C[C@@H](O)[C@H](CC[C@@H](O)CCCCC)[C@@]1([H])CC1=C(C2)C(OCC(O)=O)=CC=C1 | |
| 3 | Q9H244_DB00758 | DB00758 | Clopidogrel | antagonist | IC50(nM) = 2400.0 | GKTWGGQPFAXNFI-HNNXBMFYSA-N | [H][C@@](N1CCC2=C(C1)C=CS2)(C(=O)OC)C1=CC=CC=C1Cl |
| 4 | Q9H244_DB01240 | DB01240 | Epoprostenol | agonist | KAQKFAOMNZTLHT-OZUDYXHBSA-N | [H][C@]12C[C@@H](O)[C@H](\C=C\[C@@H](O)CCCCC)[C@@]1([H])C\C(O2)=C\CCCC(O)=O | |
| 5 | Q9H244_DB05553 | DB05553 | Regrelor | antagonist | NXHAXEBZOXCDKD-XIXRRVGJSA-N | [H][C@]12O[C@@H](O[C@@]1([H])[C@@H](O[C@@H]2COP(O)(O)=O)N1C=NC2=C1N=CN=C2NC(=O)NCC)\C=C\C1=CC=CC=C1 | |
| 6 | Q9H244_DB06209 | DB06209 | Prasugrel | antagonist | DTGLZDAWLRGWQN-UHFFFAOYSA-N | CC(=O)OC1=CC2=C(CCN(C2)C(C(=O)C2CC2)C2=CC=CC=C2F)S1 | |
| 7 | Q9H244_DB06350 | DB06350 | Elinogrel | n/a | LGSDFTPAICUONK-UHFFFAOYSA-N | CNC1=C(F)C=C2C(NC(=O)N(C2=O)C2=CC=C(NC(=O)NS(=O)(=O)C3=CC=C(Cl)S3)C=C2)=C1 | |
| 8 | Q9H244_DB06441 | DB06441 | Cangrelor | inhibitor | IC50(nM) = 0.398107 | PAEBIVWUMLRPSK-IDTAVKCVSA-N | CSCCNC1=C2N=CN([C@@H]3O[C@H](COP(O)(=O)OP(O)(=O)C(Cl)(Cl)P(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC(SCCC(F)(F)F)=N1 |
| 9 | Q9H244_DB08816 | DB08816 | Ticagrelor | inhibitor | Ki(nM) = 14.0 IC50(nM) = 5.0 | OEKWJQXRCDYSHL-FNOIDJSQSA-N | CCCSC1=NC2=C(N=NN2[C@@H]2C[C@H](OCCO)[C@@H](O)[C@H]2O)C(N[C@@H]2C[C@H]2C2=CC(F)=C(F)C=C2)=N1 |
| 10 | Q9H244_DB15163 | DB15163 | Selatogrel | antagonist | FYXHWMQPCJOJCH-GMAHTHKFSA-N | CCCCOC(=O)N1CCN(CC1)C(=O)[C@H](CP(O)(O)=O)NC(=O)C1=CC(=NC(=N1)C1=CC=CC=C1)N1CC[C@@H](C1)OC | |
| 11 | Q9H244_DB16349 | DB16349 | Vicagrel | antagonist | GNHHCBSBCDGWND-KRWDZBQOSA-N | COC(=O)[C@@H](N1CCC2=C(C1)C=C(OC(C)=O)S2)C1=C(Cl)C=CC=C1 |