Q9NWZ5 UCKL1_HUMAN
Gene name: UCKL1
Protein name: Uridine-cytidine kinase-like 1
List of molecules and drugs that target protein Q9NWZ5
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | Q9NWZ5_DB01632 | DB01632 | 5-O-phosphono-alpha-D-ribofuranosyl diphosphate | n/a | PQGCEDQWHSBAJP-TXICZTDVSA-N | O[C@H]1[C@@H](O)[C@@H](OP(O)(=O)OP(O)(O)=O)O[C@@H]1COP(O)(O)=O | |
2 | Q9NWZ5_DB03419 | DB03419 | Uracil | n/a | ISAKRJDGNUQOIC-UHFFFAOYSA-N | O=C1NC=CC(=O)N1 | |
3 | Q9NWZ5_DB03685 | DB03685 | Uridine monophosphate | n/a | DJJCXFVJDGTHFX-XVFCMESISA-N | O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP(O)(O)=O)N1C=CC(=O)NC1=O | |
4 | Q9NWZ5_DB04137 | DB04137 | Guanosine-5'-Triphosphate | n/a | XKMLYUALXHKNFT-UUOKFMHZSA-N | NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1 |