Q9UGN5 PARP2_HUMAN
Gene name: PARP2
Protein name: Poly [ADP-ribose] polymerase 2
List of molecules and drugs that target protein Q9UGN5
| # | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
|---|---|---|---|---|---|---|---|
| 1 | Q9UGN5_DB07232 | DB07232 | Veliparib | n/a | IC50(nM) = 1.3 Kd(nM) = 5.8 | JNAHVYVRKWKWKQ-CYBMUJFWSA-N | C[C@@]1(CCCN1)C1=NC2=CC=CC(C(N)=O)=C2N1 |
| 2 | Q9UGN5_DB09074 | DB09074 | Olaparib | inhibitor | FDLYAMZZIXQODN-UHFFFAOYSA-N | FC1=CC=C(CC2=NNC(=O)C3=CC=CC=C23)C=C1C(=O)N1CCN(CC1)C(=O)C1CC1 | |
| 3 | Q9UGN5_DB11760 | DB11760 | Talazoparib | inhibitor | HWGQMRYQVZSGDQ-HZPDHXFCSA-N | CN1N=CN=C1[C@@H]1[C@H](NC2=C3C1=NNC(=O)C3=CC(F)=C2)C1=CC=C(F)C=C1 | |
| 4 | Q9UGN5_DB11793 | DB11793 | Niraparib | inhibitor | PCHKPVIQAHNQLW-CQSZACIVSA-N | NC(=O)C1=CC=CC2=CN(N=C12)C1=CC=C(C=C1)[C@@H]1CCCNC1 | |
| 5 | Q9UGN5_DB12332 | DB12332 | Rucaparib | inhibitor | HMABYWSNWIZPAG-UHFFFAOYSA-N | CNCC1=CC=C(C=C1)C1=C2CCNC(=O)C3=C2C(N1)=CC(F)=C3 |