DB01268 Sunitinib
InChI Key: WINHZLLDWRZWRT-ATVHPVEESA-N
SMILES: CCN(CC)CCNC(=O)C1=C(C)NC(\C=C2/C(=O)NC3=C2C=C(F)C=C3)=C1C
Small molecule PDB accession : B49
Drug action: inhibitor
List of drug binding-associated PTMs
List of PDB structures and/or AlphaFold models with target protein P07333
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P07333 | Download | Predicted | P07333_nD5 | Protein kinase/SAICAR synthase/ATP-grasp | |
2I0V | Predicted | e2i0vA1 | |||
2I0Y | Predicted | e2i0yA1 | |||
2I1M | Predicted | e2i1mA1 | |||
2OGV | Predicted | e2ogvA1 | |||
3BEA | Predicted | e3beaA1 | |||
3DPK | Predicted | e3dpkA1 | |||
3KRJ | Predicted | e3krjA1 | |||
3KRL | Predicted | e3krlA1 | |||
3LCD | Predicted | e3lcdA1 | |||
3LCO | Predicted | e3lcoA2 | |||
4DKD | Predicted | e4dkdC4 e4dkdC5 | |||
4HW7 | Predicted | e4hw7A1 | |||
4LIQ | Predicted | e4liqE1 e4liqE5 e4liqE3 e4liqE4 e4liqE2 | |||
4R7H | Predicted | e4r7hA1 | |||
4R7I | Predicted | e4r7iA1 | |||
4WRL | Predicted | e4wrlA2 e4wrlC2 e4wrlA1 e4wrlC1 | |||
4WRM | Predicted | e4wrmA1 e4wrmA5 e4wrmA2 e4wrmA4 e4wrmA3 | |||
6IG8 | Predicted | e6ig8A1 | |||
6N33 | Predicted | e6n33A1 | |||
6T2W | Predicted | e6t2wA1 |