DB00655 Estrone
InChI Key: DNXHEGUUPJUMQT-CBZIJGRNSA-N
SMILES: [H][C@@]12CCC(=O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O)C=C3
Small molecule PDB accession : J3Z
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P11511
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P11511 | Download | Predicted | P11511_nD1 | Cytochrome P450 | |
| 3EQM | Predicted | e3eqmA1 | |||
| 3S79 | Predicted | e3s79A1 | |||
| 3S7S | Predicted | e3s7sA1 | |||
| 4GL5 | Predicted | e4gl5A1 | |||
| 4GL7 | Predicted | e4gl7A1 | |||
| 4KQ8 | Predicted | e4kq8A1 | |||
| 5JKV | Predicted | e5jkvA1 | |||
| 5JKW | Predicted | e5jkwA1 | |||
| 5JL6 | Predicted | e5jl6A1 | |||
| 5JL7 | Predicted | e5jl7A1 | |||
| 5JL9 | Predicted | e5jl9A1 |