DB00894 Testolactone
InChI Key: BPEWUONYVDABNZ-DZBHQSCQSA-N
SMILES: [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@]1(C)OC(=O)CC[C@@]21[H]
Small molecule PDB accession : n/a
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P11511
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P11511 | Download | Predicted | P11511_nD1 | Cytochrome P450 | |
| 3EQM | Predicted | e3eqmA1 | |||
| 3S79 | Predicted | e3s79A1 | |||
| 3S7S | Predicted | e3s7sA1 | |||
| 4GL5 | Predicted | e4gl5A1 | |||
| 4GL7 | Predicted | e4gl7A1 | |||
| 4KQ8 | Predicted | e4kq8A1 | |||
| 5JKV | Predicted | e5jkvA1 | |||
| 5JKW | Predicted | e5jkwA1 | |||
| 5JL6 | Predicted | e5jl6A1 | |||
| 5JL7 | Predicted | e5jl7A1 | |||
| 5JL9 | Predicted | e5jl9A1 |