DB00421 Spironolactone
InChI Key: LXMSZDCAJNLERA-ZHYRCANASA-N
SMILES: [H][C@@]12CC[C@@]3(CCC(=O)O3)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])[C@@]([H])(CC2=CC(=O)CC[C@]12C)SC(C)=O
Small molecule PDB accession : SNL
List of proteins that are targets for DB00421
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P19099_DB00421 | P19099 | antagonist | Cytochrome P450 11B2, mitochondrial | |
2 | P05093_DB00421 | P05093 | antagonist | Steroid 17-alpha-hydroxylase/17,20 lyase | |
3 | P08235_DB00421 | P08235 | antagonist | Mineralocorticoid receptor | Ki(nM) = 2.323 IC50(nM) = 1.6 |
4 | P04150_DB00421 | P04150 | antagonist | Glucocorticoid receptor | Ki(nM) = 32.6 IC50(nM) = 1400.0 EC50(nM) = 20000.0 |
5 | O75469_DB00421 | O75469 | n/a | Nuclear receptor subfamily 1 group I member 2 | |
6 | P10275_DB00421 | P10275 | antagonist | Androgen receptor | Ki(nM) = 39.4 IC50(nM) = 48.0 EC50(nM) = 20000.0 |
7 | P04278_DB00421 | P04278 | binder | Sex hormone-binding globulin | |
8 | P06401_DB00421 | P06401 | agonist | Progesterone receptor | Ki(nM) = 399.7 IC50(nM) = 650.0 EC50(nM) = 20000.0 |