DB00619 Imatinib
InChI Key: KTUFNOKKBVMGRW-UHFFFAOYSA-N
SMILES: CN1CCN(CC2=CC=C(C=C2)C(=O)NC2=CC(NC3=NC=CC(=N3)C3=CN=CC=C3)=C(C)C=C2)CC1
Small molecule PDB accession : STI
List of proteins that are targets for DB00619
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | Q08345_DB00619 | Q08345 | antagonist | Epithelial discoidin domain-containing receptor 1 | IC50(nM) = 43.0 Kd(nM) = 0.7 |
2 | Q16832_DB00619 | Q16832 | antagonist | Discoidin domain-containing receptor 2 | IC50(nM) = 141.0 Kd(nM) = 15.0 |
3 | P07333_DB00619 | P07333 | antagonist | Macrophage colony-stimulating factor 1 receptor | IC50(nM) = 291.0 Kd(nM) = 10.0 |
4 | P10721_DB00619 | P10721 | antagonist | Mast/stem cell growth factor receptor Kit | Ki(nM) = 14.0 IC50(nM) = 16.0 Kd(nM) = 3.0 EC50(nM) = 100.0 |
5 | P11274_DB00619 | P11274 | inhibitor | Breakpoint cluster region protein | |
6 | P04629_DB00619 | P04629 | antagonist | High affinity nerve growth factor receptor | Kd(nM) = 10000.0 |
7 | P16234_DB00619 | P16234 | antagonist | Platelet-derived growth factor receptor alpha | Ki(nM) = 2.0 IC50(nM) = 2.0 Kd(nM) = 31.0 EC50(nM) = 90.0 |
8 | P09619_DB00619 | P09619 | antagonist | Platelet-derived growth factor receptor beta | Ki(nM) = 3.0 IC50(nM) = 50.0 Kd(nM) = 14.0 |
9 | P00519_DB00619 | P00519 | inhibitor | Tyrosine-protein kinase ABL1 | Ki(nM) = 13.0 IC50(nM) = 1.1 Kd(nM) = 1.0 EC50(nM) = 34.0 |