DB00619 Imatinib

InChI Key: KTUFNOKKBVMGRW-UHFFFAOYSA-N
SMILES: CN1CCN(CC2=CC=C(C=C2)C(=O)NC2=CC(NC3=NC=CC(=N3)C3=CN=CC=C3)=C(C)C=C2)CC1
Small molecule PDB accession : STI

List of proteins that are targets for DB00619
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 Q08345_DB00619 Q08345 antagonist Epithelial discoidin domain-containing receptor 1 IC50(nM) = 43.0
Kd(nM) = 0.7
2 Q16832_DB00619 Q16832 antagonist Discoidin domain-containing receptor 2 IC50(nM) = 141.0
Kd(nM) = 15.0
3 P07333_DB00619 P07333 antagonist Macrophage colony-stimulating factor 1 receptor IC50(nM) = 291.0
Kd(nM) = 10.0
4 P10721_DB00619 P10721 antagonist Mast/stem cell growth factor receptor Kit Ki(nM) = 14.0
IC50(nM) = 16.0
Kd(nM) = 3.0
EC50(nM) = 100.0
5 P11274_DB00619 P11274 inhibitor Breakpoint cluster region protein
6 P04629_DB00619 P04629 antagonist High affinity nerve growth factor receptor Kd(nM) = 10000.0
7 P16234_DB00619 P16234 antagonist Platelet-derived growth factor receptor alpha Ki(nM) = 2.0
IC50(nM) = 2.0
Kd(nM) = 31.0
EC50(nM) = 90.0
8 P09619_DB00619 P09619 antagonist Platelet-derived growth factor receptor beta Ki(nM) = 3.0
IC50(nM) = 50.0
Kd(nM) = 14.0
9 P00519_DB00619 P00519 inhibitor Tyrosine-protein kinase ABL1 Ki(nM) = 13.0
IC50(nM) = 1.1
Kd(nM) = 1.0
EC50(nM) = 34.0