DB01050 Ibuprofen
InChI Key: HEFNNWSXXWATRW-UHFFFAOYSA-N
SMILES: CC(C)CC1=CC=C(C=C1)C(C)C(O)=O
Small molecule PDB accession : n/a
List of proteins that are targets for DB01050
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P23219_DB01050 | P23219 | inhibitor | Prostaglandin G/H synthase 1 | Ki(nM) = 48.0 IC50(nM) = 290.0 |
2 | P35354_DB01050 | P35354 | inhibitor | Prostaglandin G/H synthase 2 | Ki(nM) = 7200.0 IC50(nM) = 100.0 |
3 | P13569_DB01050 | P13569 | inhibitor | Cystic fibrosis transmembrane conductance regulator | |
4 | P31151_DB01050 | P31151 | inducer | Protein S100-A7 | |
5 | P12104_DB01050 | P12104 | binder | Fatty acid-binding protein, intestinal | Ki(nM) = 263500.0 |
6 | Q07869_DB01050 | Q07869 | activator | Peroxisome proliferator-activated receptor alpha | |
7 | P07359_DB01050 | P07359 | inducer | Platelet glycoprotein Ib alpha chain | |
8 | P10415_DB01050 | P10415 | modulator | Apoptosis regulator Bcl-2 | |
9 | P37231_DB01050 | P37231 | activator | Peroxisome proliferator-activated receptor gamma | |
10 | P07204_DB01050 | P07204 | inducer | Thrombomodulin |