DB01244 Bepridil
InChI Key: UIEATEWHFDRYRU-UHFFFAOYSA-N
SMILES: CC(C)COCC(CN(CC1=CC=CC=C1)C1=CC=CC=C1)N1CCCC1
Small molecule PDB accession : n/a
List of proteins that are targets for DB01244
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P05023_DB01244 | P05023 | inhibitor | Sodium/potassium-transporting ATPase subunit alpha-1 | |
2 | O00555_DB01244 | O00555 | inhibitor | Voltage-dependent P/Q-type calcium channel subunit alpha-1A | |
3 | P51787_DB01244 | P51787 | inhibitor | Potassium voltage-gated channel subfamily KQT member 1 | |
4 | Q01064_DB01244 | Q01064 | inhibitor | Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B | |
5 | P0DP23_DB01244 | P0DP23 | binder | Calmodulin-1 | |
6 | Q12809_DB01244 | Q12809 | inhibitor | Potassium voltage-gated channel subfamily H member 2 | Ki(nM) = 184.0 IC50(nM) = 22.91 |
7 | P63316_DB01244 | P63316 | other | Troponin C, slow skeletal and cardiac muscles | |
8 | O95180_DB01244 | O95180 | inhibitor | Voltage-dependent T-type calcium channel subunit alpha-1H | |
9 | Q9NY47_DB01244 | Q9NY47 | inhibitor | Voltage-dependent calcium channel subunit alpha-2/delta-2 | |
10 | P54750_DB01244 | P54750 | inhibitor | Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1A |