DB01268 Sunitinib
InChI Key: WINHZLLDWRZWRT-ATVHPVEESA-N
SMILES: CCN(CC)CCNC(=O)C1=C(C)NC(\C=C2/C(=O)NC3=C2C=C(F)C=C3)=C1C
Small molecule PDB accession : B49
List of proteins that are targets for DB01268
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P35916_DB01268 | P35916 | inhibitor | Vascular endothelial growth factor receptor 3 | Ki(nM) = 17.0 IC50(nM) = 8.9 Kd(nM) = 35.0 |
2 | P07333_DB01268 | P07333 | inhibitor | Macrophage colony-stimulating factor 1 receptor | IC50(nM) = 12.0 Kd(nM) = 2.0 |
3 | P35968_DB01268 | P35968 | inhibitor | Vascular endothelial growth factor receptor 2 | Ki(nM) = 2.9 IC50(nM) = 0.4 Kd(nM) = 0.13 |
4 | P36888_DB01268 | P36888 | inhibitor | Receptor-type tyrosine-protein kinase FLT3 | IC50(nM) = 0.7 Kd(nM) = 0.22 |
5 | P10721_DB01268 | P10721 | inhibitor | Mast/stem cell growth factor receptor Kit | Ki(nM) = 4.0 IC50(nM) = 1.1 Kd(nM) = 0.21 |
6 | P16234_DB01268 | P16234 | inhibitor | Platelet-derived growth factor receptor alpha | IC50(nM) = 6.9 Kd(nM) = 0.79 |
7 | P09619_DB01268 | P09619 | inhibitor | Platelet-derived growth factor receptor beta | Ki(nM) = 8.0 IC50(nM) = 2.0 Kd(nM) = 0.075 |
8 | P08581_DB01268 | P08581 | inhibitor | Hepatocyte growth factor receptor | IC50(nM) = 5000.0 Kd(nM) = 1200.0 |
9 | P17948_DB01268 | P17948 | inhibitor | Vascular endothelial growth factor receptor 1 | Ki(nM) = 2.0 IC50(nM) = 1.0 Kd(nM) = 1.8 |