DB01268 Sunitinib

InChI Key: WINHZLLDWRZWRT-ATVHPVEESA-N
SMILES: CCN(CC)CCNC(=O)C1=C(C)NC(\C=C2/C(=O)NC3=C2C=C(F)C=C3)=C1C
Small molecule PDB accession : B49

List of proteins that are targets for DB01268
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 P35916_DB01268 P35916 inhibitor Vascular endothelial growth factor receptor 3 Ki(nM) = 17.0
IC50(nM) = 8.9
Kd(nM) = 35.0
2 P07333_DB01268 P07333 inhibitor Macrophage colony-stimulating factor 1 receptor IC50(nM) = 12.0
Kd(nM) = 2.0
3 P35968_DB01268 P35968 inhibitor Vascular endothelial growth factor receptor 2 Ki(nM) = 2.9
IC50(nM) = 0.4
Kd(nM) = 0.13
4 P36888_DB01268 P36888 inhibitor Receptor-type tyrosine-protein kinase FLT3 IC50(nM) = 0.7
Kd(nM) = 0.22
5 P10721_DB01268 P10721 inhibitor Mast/stem cell growth factor receptor Kit Ki(nM) = 4.0
IC50(nM) = 1.1
Kd(nM) = 0.21
6 P16234_DB01268 P16234 inhibitor Platelet-derived growth factor receptor alpha IC50(nM) = 6.9
Kd(nM) = 0.79
7 P09619_DB01268 P09619 inhibitor Platelet-derived growth factor receptor beta Ki(nM) = 8.0
IC50(nM) = 2.0
Kd(nM) = 0.075
8 P08581_DB01268 P08581 inhibitor Hepatocyte growth factor receptor IC50(nM) = 5000.0
Kd(nM) = 1200.0
9 P17948_DB01268 P17948 inhibitor Vascular endothelial growth factor receptor 1 Ki(nM) = 2.0
IC50(nM) = 1.0
Kd(nM) = 1.8