DB02587 Colforsin
InChI Key: OHCQJHSOBUTRHG-KGGHGJDLSA-N
SMILES: [H][C@]1(O)CCC(C)(C)[C@]2([H])[C@]([H])(O)[C@]([H])(OC(C)=O)[C@@]3(C)O[C@](C)(CC(=O)[C@]3(O)[C@@]12C)C=C
Small molecule PDB accession : FOK
List of proteins that are targets for DB02587
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | Q02817_DB02587 | Q02817 | activator | Mucin-2 | |
2 | P63092_DB02587 | P63092 | n/a | ||
3 | P13569_DB02587 | P13569 | inhibitor | Cystic fibrosis transmembrane conductance regulator | |
4 | Q92793_DB02587 | Q92793 | activator | CREB-binding protein | |
5 | P05121_DB02587 | P05121 | inhibitor | Plasminogen activator inhibitor 1 | |
6 | O95622_DB02587 | O95622 | n/a | Adenylate cyclase type 5 | |
7 | Q08462_DB02587 | Q08462 | n/a | Adenylate cyclase type 2 |