DB02733 Purvalanol
InChI Key: ZKDXRFMOHZVXSG-HNNXBMFYSA-N
SMILES: [H][C@@](CO)(NC1=NC2=C(N=CN2C(C)C)C(NC2=CC=C(C(O)=O)C(Cl)=C2)=N1)C(C)C
Small molecule PDB accession : PVB
List of proteins that are targets for DB02733
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P27361_DB02733 | P27361 | inhibitor | Mitogen-activated protein kinase 3 | IC50(nM) = 3300.0 |
| 2 | P78362_DB02733 | P78362 | n/a | SRSF protein kinase 2 | |
| 3 | P11802_DB02733 | P11802 | n/a | Cyclin-dependent kinase 4 | IC50(nM) = 10000.0 |
| 4 | P28482_DB02733 | P28482 | inhibitor | Mitogen-activated protein kinase 1 | |
| 5 | P24941_DB02733 | P24941 | n/a | Cyclin-dependent kinase 2 | IC50(nM) = 6.0 |