DB04272 Citric acid
InChI Key: KRKNYBCHXYNGOX-UHFFFAOYSA-N
SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O
Small molecule PDB accession : CIT
List of proteins that are targets for DB04272
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | O75390_DB04272 | O75390 | n/a | Citrate synthase, mitochondrial | |
| 2 | P62312_DB04272 | P62312 | n/a | U6 snRNA-associated Sm-like protein LSm6 | |
| 3 | P40926_DB04272 | P40926 | n/a | Malate dehydrogenase, mitochondrial | |
| 4 | O14964_DB04272 | O14964 | n/a | Hepatocyte growth factor-regulated tyrosine kinase substrate | |
| 5 | Q9BY32_DB04272 | Q9BY32 | n/a | Inosine triphosphate pyrophosphatase | |
| 6 | Q9GZU7_DB04272 | Q9GZU7 | n/a | Carboxy-terminal domain RNA polymerase II polypeptide A small phosphatase 1 | |
| 7 | P07741_DB04272 | P07741 | n/a | Adenine phosphoribosyltransferase | |
| 8 | P15086_DB04272 | P15086 | n/a | Carboxypeptidase B | |
| 9 | P07360_DB04272 | P07360 | n/a | Complement component C8 gamma chain | |
| 10 | Q9HB21_DB04272 | Q9HB21 | n/a | Pleckstrin homology domain-containing family A member 1 | |
| 11 | P07998_DB04272 | P07998 | n/a | Ribonuclease pancreatic | |
| 12 | P12724_DB04272 | P12724 | n/a | Eosinophil cationic protein | |
| 13 | P15121_DB04272 | P15121 | inhibitor | Aldo-keto reductase family 1 member B1 | |
| 14 | P12931_DB04272 | P12931 | n/a | Proto-oncogene tyrosine-protein kinase Src | |
| 15 | Q96RQ9_DB04272 | Q96RQ9 | n/a | L-amino-acid oxidase |