DB06712 Nilvadipine
InChI Key: FAIIFDPAEUKBEP-UHFFFAOYSA-N
SMILES: COC(=O)C1=C(NC(C)=C(C1C1=CC(=CC=C1)[N+]([O-])=O)C(=O)OC(C)C)C#N
Small molecule PDB accession : n/a
List of proteins that are targets for DB06712
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | Q9P0X4_DB06712 | Q9P0X4 | inhibitor | Voltage-dependent T-type calcium channel subunit alpha-1I | |
| 2 | P54289_DB06712 | P54289 | inhibitor | Voltage-dependent calcium channel subunit alpha-2/delta-1 | |
| 3 | Q01668_DB06712 | Q01668 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1D | |
| 4 | Q13698_DB06712 | Q13698 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1S | |
| 5 | Q13936_DB06712 | Q13936 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1C | |
| 6 | O95180_DB06712 | O95180 | inhibitor | Voltage-dependent T-type calcium channel subunit alpha-1H | |
| 7 | Q08289_DB06712 | Q08289 | inhibitor | Voltage-dependent L-type calcium channel subunit beta-2 | |
| 8 | Q8IZS8_DB06712 | Q8IZS8 | inhibitor | Voltage-dependent calcium channel subunit alpha-2/delta-3 |