DB06905 (2S,3S,4E,6E,8S,9S)-3-amino-9-methoxy-2,6,8-trimethyl-10-phenyldeca-4,6-dienoic acid
InChI Key: HJVCHYDYCYBBQX-HLTLHRPFSA-N
SMILES: [H][C@](C)(\C=C(/C)\C=C\[C@]([H])(N)[C@]([H])(C)C(O)=O)[C@]([H])(CC1=CC=CC=C1)OC
Small molecule PDB accession : 1ZN
List of proteins that are targets for DB06905
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | Q13362_DB06905 | Q13362 | n/a | Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform | |
| 2 | P67775_DB06905 | P67775 | n/a | Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform | |
| 3 | P30153_DB06905 | P30153 | n/a | Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform |