DB08889 Carfilzomib
InChI Key: BLMPQMFVWMYDKT-NZTKNTHTSA-N
SMILES: CC(C)C[C@H](NC(=O)[C@H](CCC1=CC=CC=C1)NC(=O)CN1CCOCC1)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CC(C)C)C(=O)[C@@]1(C)CO1
Small molecule PDB accession : n/a
List of proteins that are targets for DB08889
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P28065_DB08889 | P28065 | inhibitor | Proteasome subunit beta type-9 | IC50(nM) = 69.0 |
| 2 | P40306_DB08889 | P40306 | inhibitor | Proteasome subunit beta type-10 | IC50(nM) = 13.0 |
| 3 | P28062_DB08889 | P28062 | inhibitor | Proteasome subunit beta type-8 | IC50(nM) = 3.2 |
| 4 | P49721_DB08889 | P49721 | inhibitor | Proteasome subunit beta type-2 | IC50(nM) = 203.0 |
| 5 | P28074_DB08889 | P28074 | inhibitor | Proteasome subunit beta type-5 | IC50(nM) = 2.1 |
| 6 | P20618_DB08889 | P20618 | inhibitor | Proteasome subunit beta type-1 | IC50(nM) = 1452.0 |