DB08896 Regorafenib
InChI Key: FNHKPVJBJVTLMP-UHFFFAOYSA-N
SMILES: CNC(=O)C1=CC(OC2=CC(F)=C(NC(=O)NC3=CC=C(Cl)C(=C3)C(F)(F)F)C=C2)=CC=N1
Small molecule PDB accession : n/a
List of proteins that are targets for DB08896
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P35916_DB08896 | P35916 | inhibitor | Vascular endothelial growth factor receptor 3 | IC50(nM) = 46.0 |
2 | Q15759_DB08896 | Q15759 | inhibitor | Mitogen-activated protein kinase 11 | |
3 | Q16832_DB08896 | Q16832 | inhibitor | Discoidin domain-containing receptor 2 | |
4 | P07949_DB08896 | P07949 | inhibitor | Proto-oncogene tyrosine-protein kinase receptor Ret | IC50(nM) = 1.5 |
5 | P35968_DB08896 | P35968 | inhibitor | Vascular endothelial growth factor receptor 2 | Ki(nM) = 4.2 IC50(nM) = 4.0 |
6 | P15056_DB08896 | P15056 | inhibitor | Serine/threonine-protein kinase B-raf | IC50(nM) = 1.5 |
7 | P10721_DB08896 | P10721 | inhibitor | Mast/stem cell growth factor receptor Kit | IC50(nM) = 6.1 |
8 | P29317_DB08896 | P29317 | inhibitor | Ephrin type-A receptor 2 | Kd(nM) = 869.0 |
9 | P04629_DB08896 | P04629 | inhibitor | High affinity nerve growth factor receptor | |
10 | P16234_DB08896 | P16234 | inhibitor | Platelet-derived growth factor receptor alpha | |
11 | P09619_DB08896 | P09619 | inhibitor | Platelet-derived growth factor receptor beta | IC50(nM) = 1.5 |
12 | Q02763_DB08896 | Q02763 | inhibitor | Angiopoietin-1 receptor | IC50(nM) = 1.5 |
13 | P17948_DB08896 | P17948 | inhibitor | Vascular endothelial growth factor receptor 1 | IC50(nM) = 1.5 |
14 | P21802_DB08896 | P21802 | inhibitor | Fibroblast growth factor receptor 2 | |
15 | P04049_DB08896 | P04049 | inhibitor | RAF proto-oncogene serine/threonine-protein kinase | IC50(nM) = 1.5 |
16 | P11362_DB08896 | P11362 | inhibitor | Fibroblast growth factor receptor 1 | IC50(nM) = 1.5 |
17 | P00519_DB08896 | P00519 | inhibitor | Tyrosine-protein kinase ABL1 | |
18 | P42685_DB08896 | P42685 | inhibitor | Tyrosine-protein kinase FRK |