DB08901 Ponatinib
InChI Key: PHXJVRSECIGDHY-UHFFFAOYSA-N
SMILES: CN1CCN(CC2=CC=C(NC(=O)C3=CC(C#CC4=CN=C5C=CC=NN45)=C(C)C=C3)C=C2C(F)(F)F)CC1
Small molecule PDB accession : 0LI
List of proteins that are targets for DB08901
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P22455_DB08901 | P22455 | inhibitor | Fibroblast growth factor receptor 4 | IC50(nM) = 7.1 |
2 | P07949_DB08901 | P07949 | inhibitor | Proto-oncogene tyrosine-protein kinase receptor Ret | IC50(nM) = 0.3 |
3 | P07948_DB08901 | P07948 | inhibitor | Tyrosine-protein kinase Lyn | IC50(nM) = 0.16 |
4 | P35968_DB08901 | P35968 | inhibitor | Vascular endothelial growth factor receptor 2 | Ki(nM) = 1.5 IC50(nM) = 1.5 |
5 | P22607_DB08901 | P22607 | inhibitor | Fibroblast growth factor receptor 3 | IC50(nM) = 9.4 |
6 | P36888_DB08901 | P36888 | inhibitor | Receptor-type tyrosine-protein kinase FLT3 | IC50(nM) = 0.3 |
7 | P10721_DB08901 | P10721 | inhibitor | Mast/stem cell growth factor receptor Kit | IC50(nM) = 1.7 |
8 | P11274_DB08901 | P11274 | inhibitor | Breakpoint cluster region protein | |
9 | P16234_DB08901 | P16234 | inhibitor | Platelet-derived growth factor receptor alpha | IC50(nM) = 1.1 |
10 | Q02763_DB08901 | Q02763 | inhibitor | Angiopoietin-1 receptor | |
11 | P21802_DB08901 | P21802 | inhibitor | Fibroblast growth factor receptor 2 | IC50(nM) = 1.3 |
12 | P06239_DB08901 | P06239 | inhibitor | Tyrosine-protein kinase Lck | IC50(nM) = 0.28 |
13 | P11362_DB08901 | P11362 | inhibitor | Fibroblast growth factor receptor 1 | IC50(nM) = 0.7 |
14 | P00519_DB08901 | P00519 | inhibitor | Tyrosine-protein kinase ABL1 | IC50(nM) = 0.3 Kd(nM) = 0.7 EC50(nM) = 0.05 |
15 | P12931_DB08901 | P12931 | inhibitor | Proto-oncogene tyrosine-protein kinase Src | IC50(nM) = 2.5 |