DB08912 Dabrafenib
InChI Key: BFSMGDJOXZAERB-UHFFFAOYSA-N
SMILES: CC(C)(C)C1=NC(=C(S1)C1=NC(N)=NC=C1)C1=C(F)C(NS(=O)(=O)C2=C(F)C=CC=C2F)=CC=C1
Small molecule PDB accession : P06
List of proteins that are targets for DB08912
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P53667_DB08912 | P53667 | inhibitor | LIM domain kinase 1 | |
2 | P15056_DB08912 | P15056 | inhibitor | Serine/threonine-protein kinase B-raf | IC50(nM) = 0.4 EC50(nM) = 0.7 |
3 | P04049_DB08912 | P04049 | inhibitor | RAF proto-oncogene serine/threonine-protein kinase | IC50(nM) = 150.0 |
4 | P57059_DB08912 | P57059 | inhibitor | Serine/threonine-protein kinase SIK1 | |
5 | Q8NG66_DB08912 | Q8NG66 | inhibitor | Serine/threonine-protein kinase Nek11 |